About 2,6-dimethylisoquinoline-1-thione;ethane;4-fluoro-2-methylisoquinoline-1-thione
2,6-dimethylisoquinoline-1-thione;ethane;4-fluoro-2-methylisoquinoline-1-thione (PubChem CID 155742587) has the molecular formula C27H37FN2S2
and a molecular weight of 472.74 g/mol. Its IUPAC name is 2,6-dimethylisoquinoline-1-thione;ethane;4-fluoro-2-methylisoquinoline-1-thione.
Molecular Properties
| Compound Name | 2,6-dimethylisoquinoline-1-thione;ethane;4-fluoro-2-methylisoquinoline-1-thione |
| PubChem CID | 155742587 |
| Molecular Formula | C27H37FN2S2 |
| Molecular Weight | 472.74 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 2,6-dimethylisoquinoline-1-thione;ethane;4-fluoro-2-methylisoquinoline-1-thione |
| SMILES | CC.CC.CC.Cc1ccc2c(=S)n(C)ccc2c1.Cn1cc(F)c2ccccc2c1=S |
| InChI | InChI=1S/C11H11NS.C10H8FNS.3C2H6/c1-8-3-4-10-9(7-8)5-6-12(2)11(10)13;1-12-6-9(11)7-4-2-3-5-8(7)10(12)13;3*1-2/h3-7H,1-2H3;2-6H,1H3;3*1-2H3 |
| InChIKey | LMHRHIJSFMBGGI-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.74 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethylisoquinoline-1-thione;ethane;4-fluoro-2-methylisoquinoline-1-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylisoquinoline-1-thione;ethane;4-fluoro-2-methylisoquinoline-1-thione?
The IUPAC name of 2,6-dimethylisoquinoline-1-thione;ethane;4-fluoro-2-methylisoquinoline-1-thione (CID 155742587) is 2,6-dimethylisoquinoline-1-thione;ethane;4-fluoro-2-methylisoquinoline-1-thione.
What is the SMILES notation for 2,6-dimethylisoquinoline-1-thione;ethane;4-fluoro-2-methylisoquinoline-1-thione?
The canonical SMILES for 2,6-dimethylisoquinoline-1-thione;ethane;4-fluoro-2-methylisoquinoline-1-thione is CC.CC.CC.Cc1ccc2c(=S)n(C)ccc2c1.Cn1cc(F)c2ccccc2c1=S.
What is the InChIKey of 2,6-dimethylisoquinoline-1-thione;ethane;4-fluoro-2-methylisoquinoline-1-thione?
The InChIKey is LMHRHIJSFMBGGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NS.C10H8FNS.3C2H6/c1-8-3-4-10-9(7-8)5-6-12(2)11(10)13;1-12-6-9(11)7-4-2-3-5-8(7)10(12)13;3*1-2/h3-7H,1-2H3;2-6H,1H3;3*1-2H3.
What are the key properties of 2,6-dimethylisoquinoline-1-thione;ethane;4-fluoro-2-methylisoquinoline-1-thione?
2,6-dimethylisoquinoline-1-thione;ethane;4-fluoro-2-methylisoquinoline-1-thione has a molecular weight of 472.74 g/mol, XLogP of 9.34, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylisoquinoline-1-thione;ethane;4-fluoro-2-methylisoquinoline-1-thione is sourced from PubChem (CID 155742587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).