C36H69FO5 — CID 155743293
[3-methoxy-11-(2-octylcyclopropyl)undecyl] 5-(3-fluoro-1-hydroxypropoxy)-4-methylnonanoate (PubChem CID 155743293) has the molecular formula C36H69FO5 and a molecular weight of 600.94 g/mol. Its IUPAC name is [3-methoxy-11-(2-octylcyclopropyl)undecyl] 5-(3-fluoro-1-hydroxypropoxy)-4-methylnonanoate.
| Compound Name | [3-methoxy-11-(2-octylcyclopropyl)undecyl] 5-(3-fluoro-1-hydroxypropoxy)-4-methylnonanoate |
|---|---|
| PubChem CID | 155743293 |
| Molecular Formula | C36H69FO5 |
| Molecular Weight | 600.94 g/mol |
| Exact Mass | 600.51 |
| IUPAC Name | [3-methoxy-11-(2-octylcyclopropyl)undecyl] 5-(3-fluoro-1-hydroxypropoxy)-4-methylnonanoate |
| SMILES | CCCCCCCCC1CC1CCCCCCCCC(CCOC(=O)CCC(C)C(CCCC)OC(O)CCF)OC |
| InChI | InChI=1S/C36H69FO5/c1-5-7-9-10-13-16-19-31-29-32(31)20-17-14-11-12-15-18-21-33(40-4)26-28-41-35(38)24-23-30(3)34(22-8-6-2)42-36(39)25-27-37/h30-34,36,39H,5-29H2,1-4H3 |
| InChIKey | XWBVWYJGLKOQNJ-UHFFFAOYSA-N |
| XLogP | 10.11 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.94 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|