About (3S)-3-[4-bromo-2-(1,2-oxazol-3-yl)phenoxy]-5-fluoropentan-2-imine
(3S)-3-[4-bromo-2-(1,2-oxazol-3-yl)phenoxy]-5-fluoropentan-2-imine (PubChem CID 155744369) has the molecular formula C14H14BrFN2O2
and a molecular weight of 341.18 g/mol. Its IUPAC name is (3S)-3-[4-bromo-2-(1,2-oxazol-3-yl)phenoxy]-5-fluoropentan-2-imine.
Molecular Properties
| Compound Name | (3S)-3-[4-bromo-2-(1,2-oxazol-3-yl)phenoxy]-5-fluoropentan-2-imine |
| PubChem CID | 155744369 |
| Molecular Formula | C14H14BrFN2O2 |
| Molecular Weight | 341.18 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | (3S)-3-[4-bromo-2-(1,2-oxazol-3-yl)phenoxy]-5-fluoropentan-2-imine |
| SMILES | [H]/N=C(\C)[C@H](CCF)Oc1ccc(Br)cc1-c1ccon1 |
| InChI | InChI=1S/C14H14BrFN2O2/c1-9(17)13(4-6-16)20-14-3-2-10(15)8-11(14)12-5-7-19-18-12/h2-3,5,7-8,13,17H,4,6H2,1H3/b17-9+/t13-/m0/s1 |
| InChIKey | PVFSNSSWAXCYSP-YRUBURHZSA-N |
| XLogP | 4.25 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.18 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-[4-bromo-2-(1,2-oxazol-3-yl)phenoxy]-5-fluoropentan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[4-bromo-2-(1,2-oxazol-3-yl)phenoxy]-5-fluoropentan-2-imine?
The IUPAC name of (3S)-3-[4-bromo-2-(1,2-oxazol-3-yl)phenoxy]-5-fluoropentan-2-imine (CID 155744369) is (3S)-3-[4-bromo-2-(1,2-oxazol-3-yl)phenoxy]-5-fluoropentan-2-imine.
What is the SMILES notation for (3S)-3-[4-bromo-2-(1,2-oxazol-3-yl)phenoxy]-5-fluoropentan-2-imine?
The canonical SMILES for (3S)-3-[4-bromo-2-(1,2-oxazol-3-yl)phenoxy]-5-fluoropentan-2-imine is [H]/N=C(\C)[C@H](CCF)Oc1ccc(Br)cc1-c1ccon1.
What is the InChIKey of (3S)-3-[4-bromo-2-(1,2-oxazol-3-yl)phenoxy]-5-fluoropentan-2-imine?
The InChIKey is PVFSNSSWAXCYSP-YRUBURHZSA-N. The full InChI is InChI=1S/C14H14BrFN2O2/c1-9(17)13(4-6-16)20-14-3-2-10(15)8-11(14)12-5-7-19-18-12/h2-3,5,7-8,13,17H,4,6H2,1H3/b17-9+/t13-/m0/s1.
What are the key properties of (3S)-3-[4-bromo-2-(1,2-oxazol-3-yl)phenoxy]-5-fluoropentan-2-imine?
(3S)-3-[4-bromo-2-(1,2-oxazol-3-yl)phenoxy]-5-fluoropentan-2-imine has a molecular weight of 341.18 g/mol, XLogP of 4.25, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[4-bromo-2-(1,2-oxazol-3-yl)phenoxy]-5-fluoropentan-2-imine is sourced from PubChem (CID 155744369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).