C15H19BN4O2 — CID 155744973
3-pyrimidin-5-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (PubChem CID 155744973) has the molecular formula C15H19BN4O2 and a molecular weight of 298.15 g/mol. Its IUPAC name is 3-pyrimidin-5-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine.
| Compound Name | 3-pyrimidin-5-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 155744973 |
| Molecular Formula | C15H19BN4O2 |
| Molecular Weight | 298.15 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 3-pyrimidin-5-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| SMILES | CC1(C)OB(c2cnc(N)c(-c3cncnc3)c2)OC1(C)C |
| InChI | InChI=1S/C15H19BN4O2/c1-14(2)15(3,4)22-16(21-14)11-5-12(13(17)20-8-11)10-6-18-9-19-7-10/h5-9H,1-4H3,(H2,17,20) |
| InChIKey | VXPKPZOOBZCNEH-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.15 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|