C16H19BFN3O2 — CID 155744981
3-(2-fluoro-4-pyridinyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (PubChem CID 155744981) has the molecular formula C16H19BFN3O2 and a molecular weight of 315.16 g/mol. Its IUPAC name is 3-(2-fluoro-4-pyridinyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine.
| Compound Name | 3-(2-fluoro-4-pyridinyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 155744981 |
| Molecular Formula | C16H19BFN3O2 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 3-(2-fluoro-4-pyridinyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| SMILES | CC1(C)OB(c2cnc(N)c(-c3ccnc(F)c3)c2)OC1(C)C |
| InChI | InChI=1S/C16H19BFN3O2/c1-15(2)16(3,4)23-17(22-15)11-8-12(14(19)21-9-11)10-5-6-20-13(18)7-10/h5-9H,1-4H3,(H2,19,21) |
| InChIKey | UNNVSZJQLSWVQF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|