C31H42N4O3S — CID 155745036
tert-butyl 6-[5-[6-amino-5-(1-methylsulfanylpyrazol-4-yl)-3-pyridinyl]-2-(oxan-4-yl)phenyl]heptanoate (PubChem CID 155745036) has the molecular formula C31H42N4O3S and a molecular weight of 550.77 g/mol. Its IUPAC name is tert-butyl 6-[5-[6-amino-5-(1-methylsulfanylpyrazol-4-yl)-3-pyridinyl]-2-(oxan-4-yl)phenyl]heptanoate.
| Compound Name | tert-butyl 6-[5-[6-amino-5-(1-methylsulfanylpyrazol-4-yl)-3-pyridinyl]-2-(oxan-4-yl)phenyl]heptanoate |
|---|---|
| PubChem CID | 155745036 |
| Molecular Formula | C31H42N4O3S |
| Molecular Weight | 550.77 g/mol |
| Exact Mass | 550.30 |
| IUPAC Name | tert-butyl 6-[5-[6-amino-5-(1-methylsulfanylpyrazol-4-yl)-3-pyridinyl]-2-(oxan-4-yl)phenyl]heptanoate |
| SMILES | CSn1cc(-c2cc(-c3ccc(C4CCOCC4)c(C(C)CCCCC(=O)OC(C)(C)C)c3)cnc2N)cn1 |
| InChI | InChI=1S/C31H42N4O3S/c1-21(8-6-7-9-29(36)38-31(2,3)4)27-16-23(10-11-26(27)22-12-14-37-15-13-22)24-17-28(30(32)33-18-24)25-19-34-35(20-25)39-5/h10-11,16-22H,6-9,12-15H2,1-5H3,(H2,32,33) |
| InChIKey | PGHQZUNQHUTEPY-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.77 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|