C16H38 — CID 155745671
butane;ethane;3-ethyl-2,2,3-trimethylpentane (PubChem CID 155745671) has the molecular formula C16H38 and a molecular weight of 230.48 g/mol. Its IUPAC name is butane;ethane;3-ethyl-2,2,3-trimethylpentane.
| Compound Name | butane;ethane;3-ethyl-2,2,3-trimethylpentane |
|---|---|
| PubChem CID | 155745671 |
| Molecular Formula | C16H38 |
| Molecular Weight | 230.48 g/mol |
| Exact Mass | 230.30 |
| IUPAC Name | butane;ethane;3-ethyl-2,2,3-trimethylpentane |
| SMILES | CC.CCC(C)(CC)C(C)(C)C.CCCC |
| InChI | InChI=1S/C10H22.C4H10.C2H6/c1-7-10(6,8-2)9(3,4)5;1-3-4-2;1-2/h7-8H2,1-6H3;3-4H2,1-2H3;1-2H3 |
| InChIKey | FEXKBTKZJIHDCP-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.48 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |