C13H23BN2O4 — CID 155745743
ethyl 2-[[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enylidene]amino]acetate (PubChem CID 155745743) has the molecular formula C13H23BN2O4 and a molecular weight of 282.15 g/mol. Its IUPAC name is ethyl 2-[[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enylidene]amino]acetate.
| Compound Name | ethyl 2-[[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enylidene]amino]acetate |
|---|---|
| PubChem CID | 155745743 |
| Molecular Formula | C13H23BN2O4 |
| Molecular Weight | 282.15 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | ethyl 2-[[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enylidene]amino]acetate |
| SMILES | CCOC(=O)C/N=C/C(=CN)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H23BN2O4/c1-6-18-11(17)9-16-8-10(7-15)14-19-12(2,3)13(4,5)20-14/h7-8H,6,9,15H2,1-5H3/b10-7?,16-8+ |
| InChIKey | SEZCDPZIKYNUSJ-OOSLVLPHSA-N |
| XLogP | 1.09 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.15 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|