C27H42F3N6O+ — CID 155745783
N-[3-[[2-[(6-methyl-1-octan-4-yl-2,3-dihydropyridin-1-ium-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]cyclobutanecarboxamide (PubChem CID 155745783) has the molecular formula C27H42F3N6O+ and a molecular weight of 523.67 g/mol. Its IUPAC name is N-[3-[[2-[(6-methyl-1-octan-4-yl-2,3-dihydropyridin-1-ium-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]cyclobutanecarboxamide.
| Compound Name | N-[3-[[2-[(6-methyl-1-octan-4-yl-2,3-dihydropyridin-1-ium-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 155745783 |
| Molecular Formula | C27H42F3N6O+ |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.34 |
| IUPAC Name | N-[3-[[2-[(6-methyl-1-octan-4-yl-2,3-dihydropyridin-1-ium-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]cyclobutanecarboxamide |
| SMILES | CCCCC(CCC)[N+]1=C(C)C(Nc2ncc(C(F)(F)F)c(NCCCNC(=O)C3CCC3)n2)=CCC1 |
| InChI | InChI=1S/C27H41F3N6O/c1-4-6-13-21(10-5-2)36-17-8-14-23(19(36)3)34-26-33-18-22(27(28,29)30)24(35-26)31-15-9-16-32-25(37)20-11-7-12-20/h14,18,20-21H,4-13,15-17H2,1-3H3,(H2-,31,32,33,34,35,37)/p+1 |
| InChIKey | JNTVYTACOFFJCW-UHFFFAOYSA-O |
| XLogP | 5.75 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|