C16H23ClFN4OP — CID 155745818
N-[3-[(2-chloro-5-cyclopropylpyrimidin-4-yl)amino]propyl]-3-fluoro-N-methyl-3-phosphanylcyclobutane-1-carboxamide (PubChem CID 155745818) has the molecular formula C16H23ClFN4OP and a molecular weight of 372.81 g/mol. Its IUPAC name is N-[3-[(2-chloro-5-cyclopropylpyrimidin-4-yl)amino]propyl]-3-fluoro-N-methyl-3-phosphanylcyclobutane-1-carboxamide.
| Compound Name | N-[3-[(2-chloro-5-cyclopropylpyrimidin-4-yl)amino]propyl]-3-fluoro-N-methyl-3-phosphanylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 155745818 |
| Molecular Formula | C16H23ClFN4OP |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N-[3-[(2-chloro-5-cyclopropylpyrimidin-4-yl)amino]propyl]-3-fluoro-N-methyl-3-phosphanylcyclobutane-1-carboxamide |
| SMILES | CN(CCCNc1nc(Cl)ncc1C1CC1)C(=O)C1CC(F)(P)C1 |
| InChI | InChI=1S/C16H23ClFN4OP/c1-22(14(23)11-7-16(18,24)8-11)6-2-5-19-13-12(10-3-4-10)9-20-15(17)21-13/h9-11H,2-8,24H2,1H3,(H,19,20,21) |
| InChIKey | ISEMPHDFFBOQEH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|