About methoxymethane;1-[5-[[(E)-4-oxobut-2-enoyl]oxymethyl]oxolan-2-yl]-4H-pyridine-3-carboxylic acid
methoxymethane;1-[5-[[(E)-4-oxobut-2-enoyl]oxymethyl]oxolan-2-yl]-4H-pyridine-3-carboxylic acid (PubChem CID 155746079) has the molecular formula C17H23NO7
and a molecular weight of 353.37 g/mol. Its IUPAC name is methoxymethane;1-[5-[[(E)-4-oxobut-2-enoyl]oxymethyl]oxolan-2-yl]-4H-pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | methoxymethane;1-[5-[[(E)-4-oxobut-2-enoyl]oxymethyl]oxolan-2-yl]-4H-pyridine-3-carboxylic acid |
| PubChem CID | 155746079 |
| Molecular Formula | C17H23NO7 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | methoxymethane;1-[5-[[(E)-4-oxobut-2-enoyl]oxymethyl]oxolan-2-yl]-4H-pyridine-3-carboxylic acid |
| SMILES | COC.O=C/C=C/C(=O)OCC1CCC(N2C=CCC(C(=O)O)=C2)O1 |
| InChI | InChI=1S/C15H17NO6.C2H6O/c17-8-2-4-14(18)21-10-12-5-6-13(22-12)16-7-1-3-11(9-16)15(19)20;1-3-2/h1-2,4,7-9,12-13H,3,5-6,10H2,(H,19,20);1-2H3/b4-2+; |
| InChIKey | JCBLOACEYVRPIU-VEELZWTKSA-N |
| XLogP | 1.24 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methoxymethane;1-[5-[[(E)-4-oxobut-2-enoyl]oxymethyl]oxolan-2-yl]-4H-pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethane;1-[5-[[(E)-4-oxobut-2-enoyl]oxymethyl]oxolan-2-yl]-4H-pyridine-3-carboxylic acid?
The IUPAC name of methoxymethane;1-[5-[[(E)-4-oxobut-2-enoyl]oxymethyl]oxolan-2-yl]-4H-pyridine-3-carboxylic acid (CID 155746079) is methoxymethane;1-[5-[[(E)-4-oxobut-2-enoyl]oxymethyl]oxolan-2-yl]-4H-pyridine-3-carboxylic acid.
What is the SMILES notation for methoxymethane;1-[5-[[(E)-4-oxobut-2-enoyl]oxymethyl]oxolan-2-yl]-4H-pyridine-3-carboxylic acid?
The canonical SMILES for methoxymethane;1-[5-[[(E)-4-oxobut-2-enoyl]oxymethyl]oxolan-2-yl]-4H-pyridine-3-carboxylic acid is COC.O=C/C=C/C(=O)OCC1CCC(N2C=CCC(C(=O)O)=C2)O1.
What is the InChIKey of methoxymethane;1-[5-[[(E)-4-oxobut-2-enoyl]oxymethyl]oxolan-2-yl]-4H-pyridine-3-carboxylic acid?
The InChIKey is JCBLOACEYVRPIU-VEELZWTKSA-N. The full InChI is InChI=1S/C15H17NO6.C2H6O/c17-8-2-4-14(18)21-10-12-5-6-13(22-12)16-7-1-3-11(9-16)15(19)20;1-3-2/h1-2,4,7-9,12-13H,3,5-6,10H2,(H,19,20);1-2H3/b4-2+;.
What are the key properties of methoxymethane;1-[5-[[(E)-4-oxobut-2-enoyl]oxymethyl]oxolan-2-yl]-4H-pyridine-3-carboxylic acid?
methoxymethane;1-[5-[[(E)-4-oxobut-2-enoyl]oxymethyl]oxolan-2-yl]-4H-pyridine-3-carboxylic acid has a molecular weight of 353.37 g/mol, XLogP of 1.24, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethane;1-[5-[[(E)-4-oxobut-2-enoyl]oxymethyl]oxolan-2-yl]-4H-pyridine-3-carboxylic acid is sourced from PubChem (CID 155746079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).