C34H38N2 — CID 155746820
(2Z,6E)-N-[1-[3-(8-methyl-1,2-dihydroquinolin-6-yl)phenyl]ethenyl]-3-(2-methylphenyl)nona-2,6-dien-5-amine (PubChem CID 155746820) has the molecular formula C34H38N2 and a molecular weight of 474.69 g/mol. Its IUPAC name is (2Z,6E)-N-[1-[3-(8-methyl-1,2-dihydroquinolin-6-yl)phenyl]ethenyl]-3-(2-methylphenyl)nona-2,6-dien-5-amine.
| Compound Name | (2Z,6E)-N-[1-[3-(8-methyl-1,2-dihydroquinolin-6-yl)phenyl]ethenyl]-3-(2-methylphenyl)nona-2,6-dien-5-amine |
|---|---|
| PubChem CID | 155746820 |
| Molecular Formula | C34H38N2 |
| Molecular Weight | 474.69 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | (2Z,6E)-N-[1-[3-(8-methyl-1,2-dihydroquinolin-6-yl)phenyl]ethenyl]-3-(2-methylphenyl)nona-2,6-dien-5-amine |
| SMILES | C=C(NC(/C=C/CC)C/C(=C/C)c1ccccc1C)c1cccc(-c2cc(C)c3c(c2)C=CCN3)c1 |
| InChI | InChI=1S/C34H38N2/c1-6-8-17-32(23-27(7-2)33-18-10-9-13-24(33)3)36-26(5)28-14-11-15-29(21-28)31-20-25(4)34-30(22-31)16-12-19-35-34/h7-18,20-22,32,35-36H,5-6,19,23H2,1-4H3/b17-8+,27-7- |
| InChIKey | RVYCIAITDCHOQJ-PDQGGVTPSA-N |
| XLogP | 8.80 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.69 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|