About 3-(aminomethyl)-7-ethyl-1-phenyl-4,5-dihydropyrazolo[3,4-b]pyridin-6-one;ethane;methanamine
3-(aminomethyl)-7-ethyl-1-phenyl-4,5-dihydropyrazolo[3,4-b]pyridin-6-one;ethane;methanamine (PubChem CID 155747014) has the molecular formula C19H34N6O
and a molecular weight of 362.52 g/mol. Its IUPAC name is 3-(aminomethyl)-7-ethyl-1-phenyl-4,5-dihydropyrazolo[3,4-b]pyridin-6-one;ethane;methanamine.
Molecular Properties
| Compound Name | 3-(aminomethyl)-7-ethyl-1-phenyl-4,5-dihydropyrazolo[3,4-b]pyridin-6-one;ethane;methanamine |
| PubChem CID | 155747014 |
| Molecular Formula | C19H34N6O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | 3-(aminomethyl)-7-ethyl-1-phenyl-4,5-dihydropyrazolo[3,4-b]pyridin-6-one;ethane;methanamine |
| SMILES | CC.CCN1C(=O)CCc2c(CN)nn(-c3ccccc3)c21.CN.CN |
| InChI | InChI=1S/C15H18N4O.C2H6.2CH5N/c1-2-18-14(20)9-8-12-13(10-16)17-19(15(12)18)11-6-4-3-5-7-11;3*1-2/h3-7H,2,8-10,16H2,1H3;1-2H3;2*2H2,1H3 |
| InChIKey | VFLSDGOYEKUHNM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 116.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(aminomethyl)-7-ethyl-1-phenyl-4,5-dihydropyrazolo[3,4-b]pyridin-6-one;ethane;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-7-ethyl-1-phenyl-4,5-dihydropyrazolo[3,4-b]pyridin-6-one;ethane;methanamine?
The IUPAC name of 3-(aminomethyl)-7-ethyl-1-phenyl-4,5-dihydropyrazolo[3,4-b]pyridin-6-one;ethane;methanamine (CID 155747014) is 3-(aminomethyl)-7-ethyl-1-phenyl-4,5-dihydropyrazolo[3,4-b]pyridin-6-one;ethane;methanamine.
What is the SMILES notation for 3-(aminomethyl)-7-ethyl-1-phenyl-4,5-dihydropyrazolo[3,4-b]pyridin-6-one;ethane;methanamine?
The canonical SMILES for 3-(aminomethyl)-7-ethyl-1-phenyl-4,5-dihydropyrazolo[3,4-b]pyridin-6-one;ethane;methanamine is CC.CCN1C(=O)CCc2c(CN)nn(-c3ccccc3)c21.CN.CN.
What is the InChIKey of 3-(aminomethyl)-7-ethyl-1-phenyl-4,5-dihydropyrazolo[3,4-b]pyridin-6-one;ethane;methanamine?
The InChIKey is VFLSDGOYEKUHNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4O.C2H6.2CH5N/c1-2-18-14(20)9-8-12-13(10-16)17-19(15(12)18)11-6-4-3-5-7-11;3*1-2/h3-7H,2,8-10,16H2,1H3;1-2H3;2*2H2,1H3.
What are the key properties of 3-(aminomethyl)-7-ethyl-1-phenyl-4,5-dihydropyrazolo[3,4-b]pyridin-6-one;ethane;methanamine?
3-(aminomethyl)-7-ethyl-1-phenyl-4,5-dihydropyrazolo[3,4-b]pyridin-6-one;ethane;methanamine has a molecular weight of 362.52 g/mol, XLogP of 1.81, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-7-ethyl-1-phenyl-4,5-dihydropyrazolo[3,4-b]pyridin-6-one;ethane;methanamine is sourced from PubChem (CID 155747014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).