C10H10BrNO2 — CID 155747178
2-bromo-1-(2-hydroxy-2,3-dihydro-1H-indol-5-yl)ethanone (PubChem CID 155747178) has the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. Its IUPAC name is 2-bromo-1-(2-hydroxy-2,3-dihydro-1H-indol-5-yl)ethanone.
| Compound Name | 2-bromo-1-(2-hydroxy-2,3-dihydro-1H-indol-5-yl)ethanone |
|---|---|
| PubChem CID | 155747178 |
| Molecular Formula | C10H10BrNO2 |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | 2-bromo-1-(2-hydroxy-2,3-dihydro-1H-indol-5-yl)ethanone |
| SMILES | O=C(CBr)c1ccc2c(c1)CC(O)N2 |
| InChI | InChI=1S/C10H10BrNO2/c11-5-9(13)6-1-2-8-7(3-6)4-10(14)12-8/h1-3,10,12,14H,4-5H2 |
| InChIKey | KLSRGWFESMFKOP-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|