About 3,4-dihydropyridin-5-ylmethyl prop-2-enoate
3,4-dihydropyridin-5-ylmethyl prop-2-enoate (PubChem CID 155747201) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 3,4-dihydropyridin-5-ylmethyl prop-2-enoate.
Molecular Properties
| Compound Name | 3,4-dihydropyridin-5-ylmethyl prop-2-enoate |
| PubChem CID | 155747201 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 3,4-dihydropyridin-5-ylmethyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1=CN=CCC1 |
| InChI | InChI=1S/C9H11NO2/c1-2-9(11)12-7-8-4-3-5-10-6-8/h2,5-6H,1,3-4,7H2 |
| InChIKey | PIMUPOLNLKKFBC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dihydropyridin-5-ylmethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydropyridin-5-ylmethyl prop-2-enoate?
The IUPAC name of 3,4-dihydropyridin-5-ylmethyl prop-2-enoate (CID 155747201) is 3,4-dihydropyridin-5-ylmethyl prop-2-enoate.
What is the SMILES notation for 3,4-dihydropyridin-5-ylmethyl prop-2-enoate?
The canonical SMILES for 3,4-dihydropyridin-5-ylmethyl prop-2-enoate is C=CC(=O)OCC1=CN=CCC1.
What is the InChIKey of 3,4-dihydropyridin-5-ylmethyl prop-2-enoate?
The InChIKey is PIMUPOLNLKKFBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-2-9(11)12-7-8-4-3-5-10-6-8/h2,5-6H,1,3-4,7H2.
What are the key properties of 3,4-dihydropyridin-5-ylmethyl prop-2-enoate?
3,4-dihydropyridin-5-ylmethyl prop-2-enoate has a molecular weight of 165.19 g/mol, XLogP of 1.46, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydropyridin-5-ylmethyl prop-2-enoate is sourced from PubChem (CID 155747201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).