C20H21N7O — CID 155747209
4-(2,3-dihydrofuran-5-yl)-10-[3-(4-methylphenyl)propyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine (PubChem CID 155747209) has the molecular formula C20H21N7O and a molecular weight of 375.44 g/mol. Its IUPAC name is 4-(2,3-dihydrofuran-5-yl)-10-[3-(4-methylphenyl)propyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine.
| Compound Name | 4-(2,3-dihydrofuran-5-yl)-10-[3-(4-methylphenyl)propyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
|---|---|
| PubChem CID | 155747209 |
| Molecular Formula | C20H21N7O |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 4-(2,3-dihydrofuran-5-yl)-10-[3-(4-methylphenyl)propyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
| SMILES | Cc1ccc(CCCn2ncc3c2nc(N)n2nc(C4=CCCO4)nc32)cc1 |
| InChI | InChI=1S/C20H21N7O/c1-13-6-8-14(9-7-13)4-2-10-26-18-15(12-22-26)19-23-17(16-5-3-11-28-16)25-27(19)20(21)24-18/h5-9,12H,2-4,10-11H2,1H3,(H2,21,24) |
| InChIKey | YJSZATSIURDDPD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |