C17H29N3O — CID 155748028
4-(4-tert-butylphenyl)piperazine-1-carboxamide;ethane (PubChem CID 155748028) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)piperazine-1-carboxamide;ethane.
| Compound Name | 4-(4-tert-butylphenyl)piperazine-1-carboxamide;ethane |
|---|---|
| PubChem CID | 155748028 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | 4-(4-tert-butylphenyl)piperazine-1-carboxamide;ethane |
| SMILES | CC.CC(C)(C)c1ccc(N2CCN(C(N)=O)CC2)cc1 |
| InChI | InChI=1S/C15H23N3O.C2H6/c1-15(2,3)12-4-6-13(7-5-12)17-8-10-18(11-9-17)14(16)19;1-2/h4-7H,8-11H2,1-3H3,(H2,16,19);1-2H3 |
| InChIKey | RSYZFZCXEBWPMK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |