About ethane;3-methyl-1H-imidazo[1,2-c]pyrimidine-7-thione
ethane;3-methyl-1H-imidazo[1,2-c]pyrimidine-7-thione (PubChem CID 155748378) has the molecular formula C9H13N3S
and a molecular weight of 195.29 g/mol. Its IUPAC name is ethane;3-methyl-1H-imidazo[1,2-c]pyrimidine-7-thione.
Molecular Properties
| Compound Name | ethane;3-methyl-1H-imidazo[1,2-c]pyrimidine-7-thione |
| PubChem CID | 155748378 |
| Molecular Formula | C9H13N3S |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | ethane;3-methyl-1H-imidazo[1,2-c]pyrimidine-7-thione |
| SMILES | CC.Cc1c[nH]c2cc(=S)ncn12 |
| InChI | InChI=1S/C7H7N3S.C2H6/c1-5-3-8-6-2-7(11)9-4-10(5)6;1-2/h2-4,8H,1H3;1-2H3 |
| InChIKey | RJEFBBHPHKGOJG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-methyl-1H-imidazo[1,2-c]pyrimidine-7-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-1H-imidazo[1,2-c]pyrimidine-7-thione?
The IUPAC name of ethane;3-methyl-1H-imidazo[1,2-c]pyrimidine-7-thione (CID 155748378) is ethane;3-methyl-1H-imidazo[1,2-c]pyrimidine-7-thione.
What is the SMILES notation for ethane;3-methyl-1H-imidazo[1,2-c]pyrimidine-7-thione?
The canonical SMILES for ethane;3-methyl-1H-imidazo[1,2-c]pyrimidine-7-thione is CC.Cc1c[nH]c2cc(=S)ncn12.
What is the InChIKey of ethane;3-methyl-1H-imidazo[1,2-c]pyrimidine-7-thione?
The InChIKey is RJEFBBHPHKGOJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3S.C2H6/c1-5-3-8-6-2-7(11)9-4-10(5)6;1-2/h2-4,8H,1H3;1-2H3.
What are the key properties of ethane;3-methyl-1H-imidazo[1,2-c]pyrimidine-7-thione?
ethane;3-methyl-1H-imidazo[1,2-c]pyrimidine-7-thione has a molecular weight of 195.29 g/mol, XLogP of 2.73, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-1H-imidazo[1,2-c]pyrimidine-7-thione is sourced from PubChem (CID 155748378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).