About CID 155748395
CID 155748395 (PubChem CID 155748395) has the molecular formula C8H10BNO
and a molecular weight of 146.99 g/mol.
Molecular Properties
| Compound Name | CID 155748395 |
| PubChem CID | 155748395 |
| Molecular Formula | C8H10BNO |
| Molecular Weight | 146.99 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | — |
| SMILES | [B]CC(O)c1ncccc1C |
| InChI | InChI=1S/C8H10BNO/c1-6-3-2-4-10-8(6)7(11)5-9/h2-4,7,11H,5H2,1H3 |
| InChIKey | UBYKFYLWMCZREQ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.99 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 155748395 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155748395?
The IUPAC name of CID 155748395 (CID 155748395) is not available.
What is the SMILES notation for CID 155748395?
The canonical SMILES for CID 155748395 is [B]CC(O)c1ncccc1C.
What is the InChIKey of CID 155748395?
The InChIKey is UBYKFYLWMCZREQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BNO/c1-6-3-2-4-10-8(6)7(11)5-9/h2-4,7,11H,5H2,1H3.
What are the key properties of CID 155748395?
CID 155748395 has a molecular weight of 146.99 g/mol, XLogP of 1.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155748395 is sourced from PubChem (CID 155748395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).