About 1,3-dimethylpyrazolo[4,5-c]pyridin-4-amine;ethane
1,3-dimethylpyrazolo[4,5-c]pyridin-4-amine;ethane (PubChem CID 155748773) has the molecular formula C10H16N4
and a molecular weight of 192.27 g/mol. Its IUPAC name is 1,3-dimethylpyrazolo[4,5-c]pyridin-4-amine;ethane.
Molecular Properties
| Compound Name | 1,3-dimethylpyrazolo[4,5-c]pyridin-4-amine;ethane |
| PubChem CID | 155748773 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 1,3-dimethylpyrazolo[4,5-c]pyridin-4-amine;ethane |
| SMILES | CC.Cc1nn(C)c2ccnc(N)c12 |
| InChI | InChI=1S/C8H10N4.C2H6/c1-5-7-6(12(2)11-5)3-4-10-8(7)9;1-2/h3-4H,1-2H3,(H2,9,10);1-2H3 |
| InChIKey | GAQAPZDQTGPAPV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-dimethylpyrazolo[4,5-c]pyridin-4-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylpyrazolo[4,5-c]pyridin-4-amine;ethane?
The IUPAC name of 1,3-dimethylpyrazolo[4,5-c]pyridin-4-amine;ethane (CID 155748773) is 1,3-dimethylpyrazolo[4,5-c]pyridin-4-amine;ethane.
What is the SMILES notation for 1,3-dimethylpyrazolo[4,5-c]pyridin-4-amine;ethane?
The canonical SMILES for 1,3-dimethylpyrazolo[4,5-c]pyridin-4-amine;ethane is CC.Cc1nn(C)c2ccnc(N)c12.
What is the InChIKey of 1,3-dimethylpyrazolo[4,5-c]pyridin-4-amine;ethane?
The InChIKey is GAQAPZDQTGPAPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4.C2H6/c1-5-7-6(12(2)11-5)3-4-10-8(7)9;1-2/h3-4H,1-2H3,(H2,9,10);1-2H3.
What are the key properties of 1,3-dimethylpyrazolo[4,5-c]pyridin-4-amine;ethane?
1,3-dimethylpyrazolo[4,5-c]pyridin-4-amine;ethane has a molecular weight of 192.27 g/mol, XLogP of 1.89, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylpyrazolo[4,5-c]pyridin-4-amine;ethane is sourced from PubChem (CID 155748773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).