About 2-ethoxyimidazo[1,2-a]pyridine-6-carboxamide
2-ethoxyimidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 155749147) has the molecular formula C10H11N3O2
and a molecular weight of 205.22 g/mol. Its IUPAC name is 2-ethoxyimidazo[1,2-a]pyridine-6-carboxamide.
Molecular Properties
| Compound Name | 2-ethoxyimidazo[1,2-a]pyridine-6-carboxamide |
| PubChem CID | 155749147 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-ethoxyimidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | CCOc1cn2cc(C(N)=O)ccc2n1 |
| InChI | InChI=1S/C10H11N3O2/c1-2-15-9-6-13-5-7(10(11)14)3-4-8(13)12-9/h3-6H,2H2,1H3,(H2,11,14) |
| InChIKey | ZLFWHDXQYSHYOF-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethoxyimidazo[1,2-a]pyridine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyimidazo[1,2-a]pyridine-6-carboxamide?
The IUPAC name of 2-ethoxyimidazo[1,2-a]pyridine-6-carboxamide (CID 155749147) is 2-ethoxyimidazo[1,2-a]pyridine-6-carboxamide.
What is the SMILES notation for 2-ethoxyimidazo[1,2-a]pyridine-6-carboxamide?
The canonical SMILES for 2-ethoxyimidazo[1,2-a]pyridine-6-carboxamide is CCOc1cn2cc(C(N)=O)ccc2n1.
What is the InChIKey of 2-ethoxyimidazo[1,2-a]pyridine-6-carboxamide?
The InChIKey is ZLFWHDXQYSHYOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O2/c1-2-15-9-6-13-5-7(10(11)14)3-4-8(13)12-9/h3-6H,2H2,1H3,(H2,11,14).
What are the key properties of 2-ethoxyimidazo[1,2-a]pyridine-6-carboxamide?
2-ethoxyimidazo[1,2-a]pyridine-6-carboxamide has a molecular weight of 205.22 g/mol, XLogP of 0.83, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyimidazo[1,2-a]pyridine-6-carboxamide is sourced from PubChem (CID 155749147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).