About N'-(4-aminophenyl)butanimidamide;ethane
N'-(4-aminophenyl)butanimidamide;ethane (PubChem CID 155749292) has the molecular formula C12H21N3
and a molecular weight of 207.32 g/mol. Its IUPAC name is N'-(4-aminophenyl)butanimidamide;ethane.
Molecular Properties
| Compound Name | N'-(4-aminophenyl)butanimidamide;ethane |
| PubChem CID | 155749292 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | N'-(4-aminophenyl)butanimidamide;ethane |
| SMILES | CC.CCC/C(N)=N\c1ccc(N)cc1 |
| InChI | InChI=1S/C10H15N3.C2H6/c1-2-3-10(12)13-9-6-4-8(11)5-7-9;1-2/h4-7H,2-3,11H2,1H3,(H2,12,13);1-2H3 |
| InChIKey | DQYXYLLFDZUPOK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-aminophenyl)butanimidamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-aminophenyl)butanimidamide;ethane?
The IUPAC name of N'-(4-aminophenyl)butanimidamide;ethane (CID 155749292) is N'-(4-aminophenyl)butanimidamide;ethane.
What is the SMILES notation for N'-(4-aminophenyl)butanimidamide;ethane?
The canonical SMILES for N'-(4-aminophenyl)butanimidamide;ethane is CC.CCC/C(N)=N\c1ccc(N)cc1.
What is the InChIKey of N'-(4-aminophenyl)butanimidamide;ethane?
The InChIKey is DQYXYLLFDZUPOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3.C2H6/c1-2-3-10(12)13-9-6-4-8(11)5-7-9;1-2/h4-7H,2-3,11H2,1H3,(H2,12,13);1-2H3.
What are the key properties of N'-(4-aminophenyl)butanimidamide;ethane?
N'-(4-aminophenyl)butanimidamide;ethane has a molecular weight of 207.32 g/mol, XLogP of 3.08, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-aminophenyl)butanimidamide;ethane is sourced from PubChem (CID 155749292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).