C30H35F3N6O2 — CID 155749498
1-[3-[5-[[(2R)-2-(cyanomethyl)morpholin-4-yl]methyl]-3-oxo-7-(trifluoromethyl)-1H-isoindol-2-yl]phenyl]-N,3-dimethyl-N-(methylamino)cyclobutane-1-carboximidamide (PubChem CID 155749498) has the molecular formula C30H35F3N6O2 and a molecular weight of 568.64 g/mol. Its IUPAC name is 1-[3-[5-[[(2R)-2-(cyanomethyl)morpholin-4-yl]methyl]-3-oxo-7-(trifluoromethyl)-1H-isoindol-2-yl]phenyl]-N,3-dimethyl-N-(methylamino)cyclobutane-1-carboximidamide.
| Compound Name | 1-[3-[5-[[(2R)-2-(cyanomethyl)morpholin-4-yl]methyl]-3-oxo-7-(trifluoromethyl)-1H-isoindol-2-yl]phenyl]-N,3-dimethyl-N-(methylamino)cyclobutane-1-carboximidamide |
|---|---|
| PubChem CID | 155749498 |
| Molecular Formula | C30H35F3N6O2 |
| Molecular Weight | 568.64 g/mol |
| Exact Mass | 568.28 |
| IUPAC Name | 1-[3-[5-[[(2R)-2-(cyanomethyl)morpholin-4-yl]methyl]-3-oxo-7-(trifluoromethyl)-1H-isoindol-2-yl]phenyl]-N,3-dimethyl-N-(methylamino)cyclobutane-1-carboximidamide |
| SMILES | [H]/N=C(\N(C)NC)C1(c2cccc(N3Cc4c(cc(CN5CCO[C@H](CC#N)C5)cc4C(F)(F)F)C3=O)c2)CC(C)C1 |
| InChI | InChI=1S/C30H35F3N6O2/c1-19-14-29(15-19,28(35)37(3)36-2)21-5-4-6-22(13-21)39-18-25-24(27(39)40)11-20(12-26(25)30(31,32)33)16-38-9-10-41-23(17-38)7-8-34/h4-6,11-13,19,23,35-36H,7,9-10,14-18H2,1-3H3/b35-28-/t19?,23-,29?/m1/s1 |
| InChIKey | QCMACNJSPKQKPB-VNOCJOAVSA-N |
| XLogP | 4.69 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.64 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|