About ethene;fluoromethane;(E)-2-[(E)-2-(fluoromethoxy)ethenyl]but-2-en-1-amine
ethene;fluoromethane;(E)-2-[(E)-2-(fluoromethoxy)ethenyl]but-2-en-1-amine (PubChem CID 155749554) has the molecular formula C10H19F2NO
and a molecular weight of 207.26 g/mol. Its IUPAC name is ethene;fluoromethane;(E)-2-[(E)-2-(fluoromethoxy)ethenyl]but-2-en-1-amine.
Molecular Properties
| Compound Name | ethene;fluoromethane;(E)-2-[(E)-2-(fluoromethoxy)ethenyl]but-2-en-1-amine |
| PubChem CID | 155749554 |
| Molecular Formula | C10H19F2NO |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | ethene;fluoromethane;(E)-2-[(E)-2-(fluoromethoxy)ethenyl]but-2-en-1-amine |
| SMILES | C/C=C(\C=C\OCF)CN.C=C.CF |
| InChI | InChI=1S/C7H12FNO.C2H4.CH3F/c1-2-7(5-9)3-4-10-6-8;2*1-2/h2-4H,5-6,9H2,1H3;1-2H2;1H3/b4-3+,7-2+;; |
| InChIKey | FVONBBIVZLDXNP-NWZAWHDDSA-N |
| XLogP | 2.74 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethene;fluoromethane;(E)-2-[(E)-2-(fluoromethoxy)ethenyl]but-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;fluoromethane;(E)-2-[(E)-2-(fluoromethoxy)ethenyl]but-2-en-1-amine?
The IUPAC name of ethene;fluoromethane;(E)-2-[(E)-2-(fluoromethoxy)ethenyl]but-2-en-1-amine (CID 155749554) is ethene;fluoromethane;(E)-2-[(E)-2-(fluoromethoxy)ethenyl]but-2-en-1-amine.
What is the SMILES notation for ethene;fluoromethane;(E)-2-[(E)-2-(fluoromethoxy)ethenyl]but-2-en-1-amine?
The canonical SMILES for ethene;fluoromethane;(E)-2-[(E)-2-(fluoromethoxy)ethenyl]but-2-en-1-amine is C/C=C(\C=C\OCF)CN.C=C.CF.
What is the InChIKey of ethene;fluoromethane;(E)-2-[(E)-2-(fluoromethoxy)ethenyl]but-2-en-1-amine?
The InChIKey is FVONBBIVZLDXNP-NWZAWHDDSA-N. The full InChI is InChI=1S/C7H12FNO.C2H4.CH3F/c1-2-7(5-9)3-4-10-6-8;2*1-2/h2-4H,5-6,9H2,1H3;1-2H2;1H3/b4-3+,7-2+;;.
What are the key properties of ethene;fluoromethane;(E)-2-[(E)-2-(fluoromethoxy)ethenyl]but-2-en-1-amine?
ethene;fluoromethane;(E)-2-[(E)-2-(fluoromethoxy)ethenyl]but-2-en-1-amine has a molecular weight of 207.26 g/mol, XLogP of 2.74, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;fluoromethane;(E)-2-[(E)-2-(fluoromethoxy)ethenyl]but-2-en-1-amine is sourced from PubChem (CID 155749554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).