C28H35N5O — CID 155750071
6-(ethylamino)-N-[3-[(1S)-1-[1-[(3E)-2-methylocta-1,3-dien-5-yn-3-yl]iminopropan-2-ylamino]ethyl]phenyl]pyridine-3-carboxamide (PubChem CID 155750071) has the molecular formula C28H35N5O and a molecular weight of 457.62 g/mol. Its IUPAC name is 6-(ethylamino)-N-[3-[(1S)-1-[1-[(3E)-2-methylocta-1,3-dien-5-yn-3-yl]iminopropan-2-ylamino]ethyl]phenyl]pyridine-3-carboxamide.
| Compound Name | 6-(ethylamino)-N-[3-[(1S)-1-[1-[(3E)-2-methylocta-1,3-dien-5-yn-3-yl]iminopropan-2-ylamino]ethyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155750071 |
| Molecular Formula | C28H35N5O |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | 6-(ethylamino)-N-[3-[(1S)-1-[1-[(3E)-2-methylocta-1,3-dien-5-yn-3-yl]iminopropan-2-ylamino]ethyl]phenyl]pyridine-3-carboxamide |
| SMILES | C=C(C)C(=C\C#CCC)/N=C/C(C)N[C@@H](C)c1cccc(NC(=O)c2ccc(NCC)nc2)c1 |
| InChI | InChI=1S/C28H35N5O/c1-7-9-10-14-26(20(3)4)30-18-21(5)32-22(6)23-12-11-13-25(17-23)33-28(34)24-15-16-27(29-8-2)31-19-24/h11-19,21-22,32H,3,7-8H2,1-2,4-6H3,(H,29,31)(H,33,34)/b26-14+,30-18+/t21?,22-/m0/s1 |
| InChIKey | XAEPHXQAGWYHPZ-CMRBLWBOSA-N |
| XLogP | 5.75 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|