C22H23BN6O+ — CID 155750297
CID 155750297 (PubChem CID 155750297) has the molecular formula C22H23BN6O+ and a molecular weight of 398.28 g/mol.
| Compound Name | CID 155750297 |
|---|---|
| PubChem CID | 155750297 |
| Molecular Formula | C22H23BN6O+ |
| Molecular Weight | 398.28 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | — |
| SMILES | CC[N+]1=Cc2ncc(NC(C)c3cccc(NC(=O)C4=CN=C(C5CC5)[B]4)c3)nc21 |
| InChI | InChI=1S/C22H22BN6O/c1-3-29-12-18-21(29)28-19(11-24-18)26-13(2)15-5-4-6-16(9-15)27-22(30)17-10-25-20(23-17)14-7-8-14/h4-6,9-14H,3,7-8H2,1-2H3,(H,27,30)/p+1 |
| InChIKey | JSMJRKBENVFYKF-UHFFFAOYSA-O |
| XLogP | 3.05 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|