About 1-butyl-4-(cyclobutyloxymethyl)piperidine;molecular hydrogen;propan-2-amine
1-butyl-4-(cyclobutyloxymethyl)piperidine;molecular hydrogen;propan-2-amine (PubChem CID 155750753) has the molecular formula C17H38N2O
and a molecular weight of 286.50 g/mol. Its IUPAC name is 1-butyl-4-(cyclobutyloxymethyl)piperidine;molecular hydrogen;propan-2-amine.
Molecular Properties
| Compound Name | 1-butyl-4-(cyclobutyloxymethyl)piperidine;molecular hydrogen;propan-2-amine |
| PubChem CID | 155750753 |
| Molecular Formula | C17H38N2O |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.30 |
| IUPAC Name | 1-butyl-4-(cyclobutyloxymethyl)piperidine;molecular hydrogen;propan-2-amine |
| SMILES | CC(C)N.CCCCN1CCC(COC2CCC2)CC1.[H][H] |
| InChI | InChI=1S/C14H27NO.C3H9N.H2/c1-2-3-9-15-10-7-13(8-11-15)12-16-14-5-4-6-14;1-3(2)4;/h13-14H,2-12H2,1H3;3H,4H2,1-2H3;1H |
| InChIKey | PXHHEIZFMASLBN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butyl-4-(cyclobutyloxymethyl)piperidine;molecular hydrogen;propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4-(cyclobutyloxymethyl)piperidine;molecular hydrogen;propan-2-amine?
The IUPAC name of 1-butyl-4-(cyclobutyloxymethyl)piperidine;molecular hydrogen;propan-2-amine (CID 155750753) is 1-butyl-4-(cyclobutyloxymethyl)piperidine;molecular hydrogen;propan-2-amine.
What is the SMILES notation for 1-butyl-4-(cyclobutyloxymethyl)piperidine;molecular hydrogen;propan-2-amine?
The canonical SMILES for 1-butyl-4-(cyclobutyloxymethyl)piperidine;molecular hydrogen;propan-2-amine is CC(C)N.CCCCN1CCC(COC2CCC2)CC1.[H][H].
What is the InChIKey of 1-butyl-4-(cyclobutyloxymethyl)piperidine;molecular hydrogen;propan-2-amine?
The InChIKey is PXHHEIZFMASLBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO.C3H9N.H2/c1-2-3-9-15-10-7-13(8-11-15)12-16-14-5-4-6-14;1-3(2)4;/h13-14H,2-12H2,1H3;3H,4H2,1-2H3;1H.
What are the key properties of 1-butyl-4-(cyclobutyloxymethyl)piperidine;molecular hydrogen;propan-2-amine?
1-butyl-4-(cyclobutyloxymethyl)piperidine;molecular hydrogen;propan-2-amine has a molecular weight of 286.50 g/mol, XLogP of 3.67, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4-(cyclobutyloxymethyl)piperidine;molecular hydrogen;propan-2-amine is sourced from PubChem (CID 155750753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).