C9H18N2O4S — CID 15575143
methyl (2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 15575143) has the molecular formula C9H18N2O4S and a molecular weight of 250.32 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 15575143 |
| Molecular Formula | C9H18N2O4S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)[C@H](CCSC)NC(=O)[C@@H](N)CO |
| InChI | InChI=1S/C9H18N2O4S/c1-15-9(14)7(3-4-16-2)11-8(13)6(10)5-12/h6-7,12H,3-5,10H2,1-2H3,(H,11,13)/t6-,7-/m0/s1 |
| InChIKey | ZKXMXGPHBWZQCJ-BQBZGAKWSA-N |
| XLogP | -1.28 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |