C15H17F2N3 — CID 155751604
(3Z,6S)-3-[(2Z,4Z)-5-amino-6,6-difluorohepta-2,4-dienylidene]-4-methyl-7-azabicyclo[4.2.0]octa-1,4,7-trien-6-amine (PubChem CID 155751604) has the molecular formula C15H17F2N3 and a molecular weight of 277.32 g/mol. Its IUPAC name is (3Z,6S)-3-[(2Z,4Z)-5-amino-6,6-difluorohepta-2,4-dienylidene]-4-methyl-7-azabicyclo[4.2.0]octa-1,4,7-trien-6-amine.
| Compound Name | (3Z,6S)-3-[(2Z,4Z)-5-amino-6,6-difluorohepta-2,4-dienylidene]-4-methyl-7-azabicyclo[4.2.0]octa-1,4,7-trien-6-amine |
|---|---|
| PubChem CID | 155751604 |
| Molecular Formula | C15H17F2N3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | (3Z,6S)-3-[(2Z,4Z)-5-amino-6,6-difluorohepta-2,4-dienylidene]-4-methyl-7-azabicyclo[4.2.0]octa-1,4,7-trien-6-amine |
| SMILES | CC1=C[C@]2(N)N=CC2=C/C1=C/C=C\C=C(/N)C(C)(F)F |
| InChI | InChI=1S/C15H17F2N3/c1-10-8-15(19)12(9-20-15)7-11(10)5-3-4-6-13(18)14(2,16)17/h3-9H,18-19H2,1-2H3/b4-3-,11-5-,13-6-/t15-/m0/s1 |
| InChIKey | RJWBYFZKQFFAOS-LXDPWMTPSA-N |
| XLogP | 2.59 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|