C24H19F3N4O3 — CID 155751999
N-[1-(4-formylphenyl)-6-(2-hydroxypropan-2-yl)indazol-5-yl]-3-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 155751999) has the molecular formula C24H19F3N4O3 and a molecular weight of 468.44 g/mol. Its IUPAC name is N-[1-(4-formylphenyl)-6-(2-hydroxypropan-2-yl)indazol-5-yl]-3-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-[1-(4-formylphenyl)-6-(2-hydroxypropan-2-yl)indazol-5-yl]-3-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155751999 |
| Molecular Formula | C24H19F3N4O3 |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | N-[1-(4-formylphenyl)-6-(2-hydroxypropan-2-yl)indazol-5-yl]-3-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | CC(C)(O)c1cc2c(cnn2-c2ccc(C=O)cc2)cc1NC(=O)c1ncccc1C(F)(F)F |
| InChI | InChI=1S/C24H19F3N4O3/c1-23(2,34)18-11-20-15(12-29-31(20)16-7-5-14(13-32)6-8-16)10-19(18)30-22(33)21-17(24(25,26)27)4-3-9-28-21/h3-13,34H,1-2H3,(H,30,33) |
| InChIKey | BOWMWMUPINUTSQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|