C26H40O3 — CID 155752344
ethyl (2S,11R,15R,16S)-2,16-dimethyl-6-oxo-15-prop-1-en-2-yltetracyclo[9.7.0.02,8.012,16]octadecane-5-carboxylate (PubChem CID 155752344) has the molecular formula C26H40O3 and a molecular weight of 400.60 g/mol. Its IUPAC name is ethyl (2S,11R,15R,16S)-2,16-dimethyl-6-oxo-15-prop-1-en-2-yltetracyclo[9.7.0.02,8.012,16]octadecane-5-carboxylate.
| Compound Name | ethyl (2S,11R,15R,16S)-2,16-dimethyl-6-oxo-15-prop-1-en-2-yltetracyclo[9.7.0.02,8.012,16]octadecane-5-carboxylate |
|---|---|
| PubChem CID | 155752344 |
| Molecular Formula | C26H40O3 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | ethyl (2S,11R,15R,16S)-2,16-dimethyl-6-oxo-15-prop-1-en-2-yltetracyclo[9.7.0.02,8.012,16]octadecane-5-carboxylate |
| SMILES | C=C(C)[C@H]1CCC2[C@@H]3CCC4CC(=O)C(C(=O)OCC)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C26H40O3/c1-6-29-24(28)19-11-13-25(4)17(15-23(19)27)7-8-18-21-10-9-20(16(2)3)26(21,5)14-12-22(18)25/h17-22H,2,6-15H2,1,3-5H3/t17?,18-,19?,20+,21?,22?,25-,26+/m0/s1 |
| InChIKey | UJWOQLSRUMXTNH-YEYOFJMFSA-N |
| XLogP | 5.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|