C11H12FNO3 — CID 155752770
(2Z,4Z)-4-ethenyl-5-fluoro-3-hydroxy-2-(methyliminomethyl)hepta-2,4,6-trienoic acid (PubChem CID 155752770) has the molecular formula C11H12FNO3 and a molecular weight of 225.22 g/mol. Its IUPAC name is (2Z,4Z)-4-ethenyl-5-fluoro-3-hydroxy-2-(methyliminomethyl)hepta-2,4,6-trienoic acid.
| Compound Name | (2Z,4Z)-4-ethenyl-5-fluoro-3-hydroxy-2-(methyliminomethyl)hepta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 155752770 |
| Molecular Formula | C11H12FNO3 |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | (2Z,4Z)-4-ethenyl-5-fluoro-3-hydroxy-2-(methyliminomethyl)hepta-2,4,6-trienoic acid |
| SMILES | C=C/C(F)=C(C=C)/C(O)=C(\C=N\C)C(=O)O |
| InChI | InChI=1S/C11H12FNO3/c1-4-7(9(12)5-2)10(14)8(6-13-3)11(15)16/h4-6,14H,1-2H2,3H3,(H,15,16)/b9-7-,10-8-,13-6+ |
| InChIKey | MQPSFRUOBFUAJF-AMCFAILESA-N |
| XLogP | 2.18 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|