C28H36BrN3O4 — CID 155753221
9-bromo-2-[4-(dimethylamino)cyclohexyl]-6-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2,4-dimethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5-one (PubChem CID 155753221) has the molecular formula C28H36BrN3O4 and a molecular weight of 558.52 g/mol. Its IUPAC name is 9-bromo-2-[4-(dimethylamino)cyclohexyl]-6-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2,4-dimethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5-one.
| Compound Name | 9-bromo-2-[4-(dimethylamino)cyclohexyl]-6-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2,4-dimethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5-one |
|---|---|
| PubChem CID | 155753221 |
| Molecular Formula | C28H36BrN3O4 |
| Molecular Weight | 558.52 g/mol |
| Exact Mass | 557.19 |
| IUPAC Name | 9-bromo-2-[4-(dimethylamino)cyclohexyl]-6-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2,4-dimethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-5-one |
| SMILES | Cc1cc(C)c(CN2CCc3c(Br)c4c(c(C)c3C2=O)OC(C)(C2CCC(N(C)C)CC2)O4)c(=O)[nH]1 |
| InChI | InChI=1S/C28H36BrN3O4/c1-15-13-16(2)30-26(33)21(15)14-32-12-11-20-22(27(32)34)17(3)24-25(23(20)29)36-28(4,35-24)18-7-9-19(10-8-18)31(5)6/h13,18-19H,7-12,14H2,1-6H3,(H,30,33) |
| InChIKey | BCXFQOXVZKGYFG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |