About 9,10-dimethoxy-6-[4-(trifluoromethyl)phenyl]naphtho[2,1-b][1]benzofuran
9,10-dimethoxy-6-[4-(trifluoromethyl)phenyl]naphtho[2,1-b][1]benzofuran (PubChem CID 155754001) has the molecular formula C25H17F3O3
and a molecular weight of 422.40 g/mol. Its IUPAC name is 9,10-dimethoxy-6-[4-(trifluoromethyl)phenyl]naphtho[2,1-b][1]benzofuran.
Molecular Properties
| Compound Name | 9,10-dimethoxy-6-[4-(trifluoromethyl)phenyl]naphtho[2,1-b][1]benzofuran |
| PubChem CID | 155754001 |
| Molecular Formula | C25H17F3O3 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 9,10-dimethoxy-6-[4-(trifluoromethyl)phenyl]naphtho[2,1-b][1]benzofuran |
| SMILES | COc1cc2oc3c(-c4ccc(C(F)(F)F)cc4)cc4ccccc4c3c2cc1OC |
| InChI | InChI=1S/C25H17F3O3/c1-29-21-12-19-20(13-22(21)30-2)31-24-18(11-15-5-3-4-6-17(15)23(19)24)14-7-9-16(10-8-14)25(26,27)28/h3-13H,1-2H3 |
| InChIKey | LIYWIGBLCAPBFB-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9,10-dimethoxy-6-[4-(trifluoromethyl)phenyl]naphtho[2,1-b][1]benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-dimethoxy-6-[4-(trifluoromethyl)phenyl]naphtho[2,1-b][1]benzofuran?
The IUPAC name of 9,10-dimethoxy-6-[4-(trifluoromethyl)phenyl]naphtho[2,1-b][1]benzofuran (CID 155754001) is 9,10-dimethoxy-6-[4-(trifluoromethyl)phenyl]naphtho[2,1-b][1]benzofuran.
What is the SMILES notation for 9,10-dimethoxy-6-[4-(trifluoromethyl)phenyl]naphtho[2,1-b][1]benzofuran?
The canonical SMILES for 9,10-dimethoxy-6-[4-(trifluoromethyl)phenyl]naphtho[2,1-b][1]benzofuran is COc1cc2oc3c(-c4ccc(C(F)(F)F)cc4)cc4ccccc4c3c2cc1OC.
What is the InChIKey of 9,10-dimethoxy-6-[4-(trifluoromethyl)phenyl]naphtho[2,1-b][1]benzofuran?
The InChIKey is LIYWIGBLCAPBFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H17F3O3/c1-29-21-12-19-20(13-22(21)30-2)31-24-18(11-15-5-3-4-6-17(15)23(19)24)14-7-9-16(10-8-14)25(26,27)28/h3-13H,1-2H3.
What are the key properties of 9,10-dimethoxy-6-[4-(trifluoromethyl)phenyl]naphtho[2,1-b][1]benzofuran?
9,10-dimethoxy-6-[4-(trifluoromethyl)phenyl]naphtho[2,1-b][1]benzofuran has a molecular weight of 422.40 g/mol, XLogP of 7.44, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-dimethoxy-6-[4-(trifluoromethyl)phenyl]naphtho[2,1-b][1]benzofuran is sourced from PubChem (CID 155754001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).