C19H29N3O3 — CID 155754445
tert-butyl 10-[(2-oxopyrazin-1-yl)methyl]-7-azaspiro[4.5]decane-7-carboxylate (PubChem CID 155754445) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is tert-butyl 10-[(2-oxopyrazin-1-yl)methyl]-7-azaspiro[4.5]decane-7-carboxylate.
| Compound Name | tert-butyl 10-[(2-oxopyrazin-1-yl)methyl]-7-azaspiro[4.5]decane-7-carboxylate |
|---|---|
| PubChem CID | 155754445 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | tert-butyl 10-[(2-oxopyrazin-1-yl)methyl]-7-azaspiro[4.5]decane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Cn2ccncc2=O)C2(CCCC2)C1 |
| InChI | InChI=1S/C19H29N3O3/c1-18(2,3)25-17(24)22-10-6-15(19(14-22)7-4-5-8-19)13-21-11-9-20-12-16(21)23/h9,11-12,15H,4-8,10,13-14H2,1-3H3 |
| InChIKey | ZULIRSSKHUEIJJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |