C19H17F2IN4O2 — CID 155754843
N-[2-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-2-oxoethyl]-1-[(3-iodophenyl)methyl]pyrrole-3-carboxamide (PubChem CID 155754843) has the molecular formula C19H17F2IN4O2 and a molecular weight of 498.27 g/mol. Its IUPAC name is N-[2-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-2-oxoethyl]-1-[(3-iodophenyl)methyl]pyrrole-3-carboxamide.
| Compound Name | N-[2-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-2-oxoethyl]-1-[(3-iodophenyl)methyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 155754843 |
| Molecular Formula | C19H17F2IN4O2 |
| Molecular Weight | 498.27 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | N-[2-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-2-oxoethyl]-1-[(3-iodophenyl)methyl]pyrrole-3-carboxamide |
| SMILES | N#C[C@@H]1CC(F)(F)CN1C(=O)CNC(=O)c1ccn(Cc2cccc(I)c2)c1 |
| InChI | InChI=1S/C19H17F2IN4O2/c20-19(21)7-16(8-23)26(12-19)17(27)9-24-18(28)14-4-5-25(11-14)10-13-2-1-3-15(22)6-13/h1-6,11,16H,7,9-10,12H2,(H,24,28)/t16-/m0/s1 |
| InChIKey | AZUZDDRLVXGSTH-INIZCTEOSA-N |
| XLogP | 2.63 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|