C28H22Br2N2O2 — CID 155755560
2-[(3R,4S)-4-(4-bromobenzoyl)-3-phenyl-3,4-dihydropyrrolo[1,2-a]pyrazin-2-ium-2-yl]-1-phenylethanone bromide (PubChem CID 155755560) has the molecular formula C28H22Br2N2O2 and a molecular weight of 578.30 g/mol. Its IUPAC name is 2-[(3R,4S)-4-(4-bromobenzoyl)-3-phenyl-3,4-dihydropyrrolo[1,2-a]pyrazin-2-ium-2-yl]-1-phenylethanone bromide.
| Compound Name | 2-[(3R,4S)-4-(4-bromobenzoyl)-3-phenyl-3,4-dihydropyrrolo[1,2-a]pyrazin-2-ium-2-yl]-1-phenylethanone bromide |
|---|---|
| PubChem CID | 155755560 |
| Molecular Formula | C28H22Br2N2O2 |
| Molecular Weight | 578.30 g/mol |
| Exact Mass | 576.00 |
| IUPAC Name | 2-[(3R,4S)-4-(4-bromobenzoyl)-3-phenyl-3,4-dihydropyrrolo[1,2-a]pyrazin-2-ium-2-yl]-1-phenylethanone bromide |
| SMILES | O=C(C[N+]1=Cc2cccn2[C@H](C(=O)c2ccc(Br)cc2)[C@H]1c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C28H22BrN2O2.BrH/c29-23-15-13-22(14-16-23)28(33)27-26(21-10-5-2-6-11-21)30(18-24-12-7-17-31(24)27)19-25(32)20-8-3-1-4-9-20;/h1-18,26-27H,19H2;1H/q+1;/p-1/t26-,27+;/m1./s1 |
| InChIKey | BQNYBAXDUYWIIV-OUPRKWGVSA-M |
| XLogP | 2.75 |
| TPSA | 42.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_H(3)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|