C24H22Br2N2O3 — CID 155755586
ethyl 2-[(3R,4S)-4-(4-bromobenzoyl)-3-phenyl-3,4-dihydropyrrolo[1,2-a]pyrazin-2-ium-2-yl]acetate bromide (PubChem CID 155755586) has the molecular formula C24H22Br2N2O3 and a molecular weight of 546.26 g/mol. Its IUPAC name is ethyl 2-[(3R,4S)-4-(4-bromobenzoyl)-3-phenyl-3,4-dihydropyrrolo[1,2-a]pyrazin-2-ium-2-yl]acetate bromide.
| Compound Name | ethyl 2-[(3R,4S)-4-(4-bromobenzoyl)-3-phenyl-3,4-dihydropyrrolo[1,2-a]pyrazin-2-ium-2-yl]acetate bromide |
|---|---|
| PubChem CID | 155755586 |
| Molecular Formula | C24H22Br2N2O3 |
| Molecular Weight | 546.26 g/mol |
| Exact Mass | 544.00 |
| IUPAC Name | ethyl 2-[(3R,4S)-4-(4-bromobenzoyl)-3-phenyl-3,4-dihydropyrrolo[1,2-a]pyrazin-2-ium-2-yl]acetate bromide |
| SMILES | CCOC(=O)C[N+]1=Cc2cccn2[C@H](C(=O)c2ccc(Br)cc2)[C@H]1c1ccccc1.[Br-] |
| InChI | InChI=1S/C24H22BrN2O3.BrH/c1-2-30-21(28)16-26-15-20-9-6-14-27(20)23(22(26)17-7-4-3-5-8-17)24(29)18-10-12-19(25)13-11-18;/h3-15,22-23H,2,16H2,1H3;1H/q+1;/p-1/t22-,23+;/m1./s1 |
| InChIKey | DNXLZRIFQMLSGB-RFPXDPOKSA-M |
| XLogP | 1.43 |
| TPSA | 51.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_H(3)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|