C27H24N4O2S — CID 155755920
(E)-1-[10-(4-benzylsulfanylanilino)-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]but-2-en-1-one (PubChem CID 155755920) has the molecular formula C27H24N4O2S and a molecular weight of 468.58 g/mol. Its IUPAC name is (E)-1-[10-(4-benzylsulfanylanilino)-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]but-2-en-1-one.
| Compound Name | (E)-1-[10-(4-benzylsulfanylanilino)-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 155755920 |
| Molecular Formula | C27H24N4O2S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | (E)-1-[10-(4-benzylsulfanylanilino)-2,3-dihydropyrimido[4,5-h][1,4]benzoxazin-4-yl]but-2-en-1-one |
| SMILES | C/C=C/C(=O)N1CCOc2c1ccc1ncnc(Nc3ccc(SCc4ccccc4)cc3)c21 |
| InChI | InChI=1S/C27H24N4O2S/c1-2-6-24(32)31-15-16-33-26-23(31)14-13-22-25(26)27(29-18-28-22)30-20-9-11-21(12-10-20)34-17-19-7-4-3-5-8-19/h2-14,18H,15-17H2,1H3,(H,28,29,30)/b6-2+ |
| InChIKey | DEDGYINWVWAVSC-QHHAFSJGSA-N |
| XLogP | 5.97 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|