C27H29N5O3 — CID 155755996
N-[4-[2-[3-(dimethylamino)propoxy]phenoxy]phenyl]-3,4-dihydro-2H-pyrimido[4,5-h][1,4]benzoxazin-10-amine (PubChem CID 155755996) has the molecular formula C27H29N5O3 and a molecular weight of 471.56 g/mol. Its IUPAC name is N-[4-[2-[3-(dimethylamino)propoxy]phenoxy]phenyl]-3,4-dihydro-2H-pyrimido[4,5-h][1,4]benzoxazin-10-amine.
| Compound Name | N-[4-[2-[3-(dimethylamino)propoxy]phenoxy]phenyl]-3,4-dihydro-2H-pyrimido[4,5-h][1,4]benzoxazin-10-amine |
|---|---|
| PubChem CID | 155755996 |
| Molecular Formula | C27H29N5O3 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | N-[4-[2-[3-(dimethylamino)propoxy]phenoxy]phenyl]-3,4-dihydro-2H-pyrimido[4,5-h][1,4]benzoxazin-10-amine |
| SMILES | CN(C)CCCOc1ccccc1Oc1ccc(Nc2ncnc3ccc4c(c23)OCCN4)cc1 |
| InChI | InChI=1S/C27H29N5O3/c1-32(2)15-5-16-33-23-6-3-4-7-24(23)35-20-10-8-19(9-11-20)31-27-25-21(29-18-30-27)12-13-22-26(25)34-17-14-28-22/h3-4,6-13,18,28H,5,14-17H2,1-2H3,(H,29,30,31) |
| InChIKey | GLGCURLVDHXFKF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 80.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|