About propyl N-[3-(dimethylamino)propyl]carbamate;hydrochloride
propyl N-[3-(dimethylamino)propyl]carbamate;hydrochloride (PubChem CID 15575641) has the molecular formula C9H21ClN2O2
and a molecular weight of 224.73 g/mol. Its IUPAC name is propyl N-[3-(dimethylamino)propyl]carbamate;hydrochloride.
Molecular Properties
| Compound Name | propyl N-[3-(dimethylamino)propyl]carbamate;hydrochloride |
| PubChem CID | 15575641 |
| Molecular Formula | C9H21ClN2O2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | propyl N-[3-(dimethylamino)propyl]carbamate;hydrochloride |
| SMILES | CCCOC(=O)NCCCN(C)C.Cl |
| InChI | InChI=1S/C9H20N2O2.ClH/c1-4-8-13-9(12)10-6-5-7-11(2)3;/h4-8H2,1-3H3,(H,10,12);1H |
| InChIKey | MKIMSXGUTQTKJU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze propyl N-[3-(dimethylamino)propyl]carbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl N-[3-(dimethylamino)propyl]carbamate;hydrochloride?
The IUPAC name of propyl N-[3-(dimethylamino)propyl]carbamate;hydrochloride (CID 15575641) is propyl N-[3-(dimethylamino)propyl]carbamate;hydrochloride.
What is the SMILES notation for propyl N-[3-(dimethylamino)propyl]carbamate;hydrochloride?
The canonical SMILES for propyl N-[3-(dimethylamino)propyl]carbamate;hydrochloride is CCCOC(=O)NCCCN(C)C.Cl.
What is the InChIKey of propyl N-[3-(dimethylamino)propyl]carbamate;hydrochloride?
The InChIKey is MKIMSXGUTQTKJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O2.ClH/c1-4-8-13-9(12)10-6-5-7-11(2)3;/h4-8H2,1-3H3,(H,10,12);1H.
What are the key properties of propyl N-[3-(dimethylamino)propyl]carbamate;hydrochloride?
propyl N-[3-(dimethylamino)propyl]carbamate;hydrochloride has a molecular weight of 224.73 g/mol, XLogP of 1.50, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl N-[3-(dimethylamino)propyl]carbamate;hydrochloride is sourced from PubChem (CID 15575641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).