C24H24N8O3 — CID 155757753
2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-[(3R)-oxan-3-yl]-2-phenylpropanamide (PubChem CID 155757753) has the molecular formula C24H24N8O3 and a molecular weight of 472.51 g/mol. Its IUPAC name is 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-[(3R)-oxan-3-yl]-2-phenylpropanamide.
| Compound Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-[(3R)-oxan-3-yl]-2-phenylpropanamide |
|---|---|
| PubChem CID | 155757753 |
| Molecular Formula | C24H24N8O3 |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]-N-[(3R)-oxan-3-yl]-2-phenylpropanamide |
| SMILES | CC(C(=O)N[C@@H]1CCCOC1)(c1ccccc1)n1ncc2c1nc(N)n1nc(-c3ccco3)nc21 |
| InChI | InChI=1S/C24H24N8O3/c1-24(15-7-3-2-4-8-15,22(33)27-16-9-5-11-34-14-16)32-21-17(13-26-32)20-28-19(18-10-6-12-35-18)30-31(20)23(25)29-21/h2-4,6-8,10,12-13,16H,5,9,11,14H2,1H3,(H2,25,29)(H,27,33)/t16-,24?/m1/s1 |
| InChIKey | CUDKDDOBNUDXCX-YAOANENCSA-N |
| XLogP | 2.37 |
| TPSA | 138.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |