About (4-ethylmorpholin-3-yl) 1-pyridin-3-ylpyrazole-4-carboxylate
(4-ethylmorpholin-3-yl) 1-pyridin-3-ylpyrazole-4-carboxylate (PubChem CID 155759017) has the molecular formula C15H18N4O3
and a molecular weight of 302.33 g/mol. Its IUPAC name is (4-ethylmorpholin-3-yl) 1-pyridin-3-ylpyrazole-4-carboxylate.
Molecular Properties
| Compound Name | (4-ethylmorpholin-3-yl) 1-pyridin-3-ylpyrazole-4-carboxylate |
| PubChem CID | 155759017 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (4-ethylmorpholin-3-yl) 1-pyridin-3-ylpyrazole-4-carboxylate |
| SMILES | CCN1CCOCC1OC(=O)c1cnn(-c2cccnc2)c1 |
| InChI | InChI=1S/C15H18N4O3/c1-2-18-6-7-21-11-14(18)22-15(20)12-8-17-19(10-12)13-4-3-5-16-9-13/h3-5,8-10,14H,2,6-7,11H2,1H3 |
| InChIKey | DICINSCGCPQLHD-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (4-ethylmorpholin-3-yl) 1-pyridin-3-ylpyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethylmorpholin-3-yl) 1-pyridin-3-ylpyrazole-4-carboxylate?
The IUPAC name of (4-ethylmorpholin-3-yl) 1-pyridin-3-ylpyrazole-4-carboxylate (CID 155759017) is (4-ethylmorpholin-3-yl) 1-pyridin-3-ylpyrazole-4-carboxylate.
What is the SMILES notation for (4-ethylmorpholin-3-yl) 1-pyridin-3-ylpyrazole-4-carboxylate?
The canonical SMILES for (4-ethylmorpholin-3-yl) 1-pyridin-3-ylpyrazole-4-carboxylate is CCN1CCOCC1OC(=O)c1cnn(-c2cccnc2)c1.
What is the InChIKey of (4-ethylmorpholin-3-yl) 1-pyridin-3-ylpyrazole-4-carboxylate?
The InChIKey is DICINSCGCPQLHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4O3/c1-2-18-6-7-21-11-14(18)22-15(20)12-8-17-19(10-12)13-4-3-5-16-9-13/h3-5,8-10,14H,2,6-7,11H2,1H3.
What are the key properties of (4-ethylmorpholin-3-yl) 1-pyridin-3-ylpyrazole-4-carboxylate?
(4-ethylmorpholin-3-yl) 1-pyridin-3-ylpyrazole-4-carboxylate has a molecular weight of 302.33 g/mol, XLogP of 1.10, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethylmorpholin-3-yl) 1-pyridin-3-ylpyrazole-4-carboxylate is sourced from PubChem (CID 155759017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).