About [4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylimino-methyl-oxo-phenyl-λ6-sulfane
[4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylimino-methyl-oxo-phenyl-λ6-sulfane (PubChem CID 155759722) has the molecular formula C17H15F2N3O2S
and a molecular weight of 363.39 g/mol. Its IUPAC name is [4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylimino-methyl-oxo-phenyl-λ6-sulfane.
Molecular Properties
| Compound Name | [4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylimino-methyl-oxo-phenyl-λ6-sulfane |
| PubChem CID | 155759722 |
| Molecular Formula | C17H15F2N3O2S |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | [4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylimino-methyl-oxo-phenyl-λ6-sulfane |
| SMILES | CS(=O)(=NCc1ccc(-c2noc(C(F)F)n2)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H15F2N3O2S/c1-25(23,14-5-3-2-4-6-14)20-11-12-7-9-13(10-8-12)16-21-17(15(18)19)24-22-16/h2-10,15H,11H2,1H3 |
| InChIKey | BIRNATYPWFDFOH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 68.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylimino-methyl-oxo-phenyl-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylimino-methyl-oxo-phenyl-λ6-sulfane?
The IUPAC name of [4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylimino-methyl-oxo-phenyl-λ6-sulfane (CID 155759722) is [4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylimino-methyl-oxo-phenyl-λ6-sulfane.
What is the SMILES notation for [4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylimino-methyl-oxo-phenyl-λ6-sulfane?
The canonical SMILES for [4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylimino-methyl-oxo-phenyl-λ6-sulfane is CS(=O)(=NCc1ccc(-c2noc(C(F)F)n2)cc1)c1ccccc1.
What is the InChIKey of [4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylimino-methyl-oxo-phenyl-λ6-sulfane?
The InChIKey is BIRNATYPWFDFOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F2N3O2S/c1-25(23,14-5-3-2-4-6-14)20-11-12-7-9-13(10-8-12)16-21-17(15(18)19)24-22-16/h2-10,15H,11H2,1H3.
What are the key properties of [4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylimino-methyl-oxo-phenyl-λ6-sulfane?
[4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylimino-methyl-oxo-phenyl-λ6-sulfane has a molecular weight of 363.39 g/mol, XLogP of 4.33, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylimino-methyl-oxo-phenyl-λ6-sulfane is sourced from PubChem (CID 155759722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).