About 3-acetamido-5-amino-2,4,6-triiodobenzoic acid
3-acetamido-5-amino-2,4,6-triiodobenzoic acid (PubChem CID 15576) has the molecular formula C9H7I3N2O3
and a molecular weight of 571.88 g/mol. Its IUPAC name is 3-acetamido-5-amino-2,4,6-triiodobenzoic acid.
Molecular Properties
| Compound Name | 3-acetamido-5-amino-2,4,6-triiodobenzoic acid |
| PubChem CID | 15576 |
| Molecular Formula | C9H7I3N2O3 |
| Molecular Weight | 571.88 g/mol |
| Exact Mass | 571.76 |
| IUPAC Name | 3-acetamido-5-amino-2,4,6-triiodobenzoic acid |
| SMILES | CC(=O)Nc1c(I)c(N)c(I)c(C(=O)O)c1I |
| InChI | InChI=1S/C9H7I3N2O3/c1-2(15)14-8-5(11)3(9(16)17)4(10)7(13)6(8)12/h13H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | XCNHOBHCZBIGJP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 571.88 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-acetamido-5-amino-2,4,6-triiodobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetamido-5-amino-2,4,6-triiodobenzoic acid?
The IUPAC name of 3-acetamido-5-amino-2,4,6-triiodobenzoic acid (CID 15576) is 3-acetamido-5-amino-2,4,6-triiodobenzoic acid.
What is the SMILES notation for 3-acetamido-5-amino-2,4,6-triiodobenzoic acid?
The canonical SMILES for 3-acetamido-5-amino-2,4,6-triiodobenzoic acid is CC(=O)Nc1c(I)c(N)c(I)c(C(=O)O)c1I.
What is the InChIKey of 3-acetamido-5-amino-2,4,6-triiodobenzoic acid?
The InChIKey is XCNHOBHCZBIGJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7I3N2O3/c1-2(15)14-8-5(11)3(9(16)17)4(10)7(13)6(8)12/h13H2,1H3,(H,14,15)(H,16,17).
What are the key properties of 3-acetamido-5-amino-2,4,6-triiodobenzoic acid?
3-acetamido-5-amino-2,4,6-triiodobenzoic acid has a molecular weight of 571.88 g/mol, XLogP of 2.74, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetamido-5-amino-2,4,6-triiodobenzoic acid is sourced from PubChem (CID 15576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).