C32H46ClFN6O5Si — CID 155760559
butyl N-[(3S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[5-[(6-chloropyridine-2-carbonyl)amino]-7-fluoro-1-(2-methoxyethyl)indazol-4-yl]pyrrolidin-3-yl]carbamate (PubChem CID 155760559) has the molecular formula C32H46ClFN6O5Si and a molecular weight of 677.29 g/mol. Its IUPAC name is butyl N-[(3S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[5-[(6-chloropyridine-2-carbonyl)amino]-7-fluoro-1-(2-methoxyethyl)indazol-4-yl]pyrrolidin-3-yl]carbamate.
| Compound Name | butyl N-[(3S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[5-[(6-chloropyridine-2-carbonyl)amino]-7-fluoro-1-(2-methoxyethyl)indazol-4-yl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 155760559 |
| Molecular Formula | C32H46ClFN6O5Si |
| Molecular Weight | 677.29 g/mol |
| Exact Mass | 676.30 |
| IUPAC Name | butyl N-[(3S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[5-[(6-chloropyridine-2-carbonyl)amino]-7-fluoro-1-(2-methoxyethyl)indazol-4-yl]pyrrolidin-3-yl]carbamate |
| SMILES | CCCCOC(=O)N[C@H]1C[C@@H](CO[Si](C)(C)C(C)(C)C)N(c2c(NC(=O)c3cccc(Cl)n3)cc(F)c3c2cnn3CCOC)C1 |
| InChI | InChI=1S/C32H46ClFN6O5Si/c1-8-9-14-44-31(42)36-21-16-22(20-45-46(6,7)32(2,3)4)39(19-21)29-23-18-35-40(13-15-43-5)28(23)24(34)17-26(29)38-30(41)25-11-10-12-27(33)37-25/h10-12,17-18,21-22H,8-9,13-16,19-20H2,1-7H3,(H,36,42)(H,38,41)/t21-,22-/m0/s1 |
| InChIKey | WRJXKJWPCHEZLN-VXKWHMMOSA-N |
| XLogP | 6.62 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.29 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|