C42H37NOSi2 — CID 155761195
18,18,21,21-tetramethyl-N,N-bis(4-methylphenyl)-9-oxa-18,21-disilaheptacyclo[18.7.0.02,10.03,8.011,19.012,17.022,27]heptacosa-1,3,5,7,10,12,14,16,19,22(27),23,25-dodecaen-24-amine (PubChem CID 155761195) has the molecular formula C42H37NOSi2 and a molecular weight of 627.94 g/mol. Its IUPAC name is 18,18,21,21-tetramethyl-N,N-bis(4-methylphenyl)-9-oxa-18,21-disilaheptacyclo[18.7.0.02,10.03,8.011,19.012,17.022,27]heptacosa-1,3,5,7,10,12,14,16,19,22(27),23,25-dodecaen-24-amine.
| Compound Name | 18,18,21,21-tetramethyl-N,N-bis(4-methylphenyl)-9-oxa-18,21-disilaheptacyclo[18.7.0.02,10.03,8.011,19.012,17.022,27]heptacosa-1,3,5,7,10,12,14,16,19,22(27),23,25-dodecaen-24-amine |
|---|---|
| PubChem CID | 155761195 |
| Molecular Formula | C42H37NOSi2 |
| Molecular Weight | 627.94 g/mol |
| Exact Mass | 627.24 |
| IUPAC Name | 18,18,21,21-tetramethyl-N,N-bis(4-methylphenyl)-9-oxa-18,21-disilaheptacyclo[18.7.0.02,10.03,8.011,19.012,17.022,27]heptacosa-1,3,5,7,10,12,14,16,19,22(27),23,25-dodecaen-24-amine |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc3c(c2)[Si](C)(C)c2c4c(c5oc6ccccc6c5c2-3)-c2ccccc2[Si]4(C)C)cc1 |
| InChI | InChI=1S/C42H37NOSi2/c1-26-15-19-28(20-16-26)43(29-21-17-27(2)18-22-29)30-23-24-33-36(25-30)46(5,6)41-38(33)37-31-11-7-9-13-34(31)44-40(37)39-32-12-8-10-14-35(32)45(3,4)42(39)41/h7-25H,1-6H3 |
| InChIKey | ZIVBQOLSQHNOPE-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.94 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|