C25H20F2N4O2 — CID 155762312
7-fluoro-9-[(4-fluorophenyl)methyl]-6-piperazin-1-yl-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3(8),4,6,11,13-hexaene-2,16-dione (PubChem CID 155762312) has the molecular formula C25H20F2N4O2 and a molecular weight of 446.46 g/mol. Its IUPAC name is 7-fluoro-9-[(4-fluorophenyl)methyl]-6-piperazin-1-yl-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3(8),4,6,11,13-hexaene-2,16-dione.
| Compound Name | 7-fluoro-9-[(4-fluorophenyl)methyl]-6-piperazin-1-yl-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3(8),4,6,11,13-hexaene-2,16-dione |
|---|---|
| PubChem CID | 155762312 |
| Molecular Formula | C25H20F2N4O2 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 7-fluoro-9-[(4-fluorophenyl)methyl]-6-piperazin-1-yl-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3(8),4,6,11,13-hexaene-2,16-dione |
| SMILES | O=C1c2c(n(Cc3ccc(F)cc3)c3c(F)c(N4CCNCC4)ccc3c2=O)-c2cccn21 |
| InChI | InChI=1S/C25H20F2N4O2/c26-16-5-3-15(4-6-16)14-31-22-17(7-8-18(21(22)27)29-12-9-28-10-13-29)24(32)20-23(31)19-2-1-11-30(19)25(20)33/h1-8,11,28H,9-10,12-14H2 |
| InChIKey | OMHHXAVBOPFNOB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 59.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |