C11H12N5O2+ — CID 155762382
3-[4-(2-aminopyrimidin-4-yl)pyridazin-1-ium-1-yl]propanoic acid (PubChem CID 155762382) has the molecular formula C11H12N5O2+ and a molecular weight of 246.25 g/mol. Its IUPAC name is 3-[4-(2-aminopyrimidin-4-yl)pyridazin-1-ium-1-yl]propanoic acid.
| Compound Name | 3-[4-(2-aminopyrimidin-4-yl)pyridazin-1-ium-1-yl]propanoic acid |
|---|---|
| PubChem CID | 155762382 |
| Molecular Formula | C11H12N5O2+ |
| Molecular Weight | 246.25 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 3-[4-(2-aminopyrimidin-4-yl)pyridazin-1-ium-1-yl]propanoic acid |
| SMILES | Nc1nccc(-c2cc[n+](CCC(=O)O)nc2)n1 |
| InChI | InChI=1S/C11H11N5O2/c12-11-13-4-1-9(15-11)8-2-5-16(14-7-8)6-3-10(17)18/h1-2,4-5,7H,3,6H2,(H2-,12,13,15,17,18)/p+1 |
| InChIKey | OCXHOVMDVZMFTM-UHFFFAOYSA-O |
| XLogP | -0.12 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.25 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|