C24H28N2O — CID 155762879
N'-[(3-methoxyphenyl)-diphenylmethyl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 155762879) has the molecular formula C24H28N2O and a molecular weight of 360.50 g/mol. Its IUPAC name is N'-[(3-methoxyphenyl)-diphenylmethyl]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-[(3-methoxyphenyl)-diphenylmethyl]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 155762879 |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | N'-[(3-methoxyphenyl)-diphenylmethyl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | CNCCN(C)C(c1ccccc1)(c1ccccc1)c1cccc(OC)c1 |
| InChI | InChI=1S/C24H28N2O/c1-25-17-18-26(2)24(20-11-6-4-7-12-20,21-13-8-5-9-14-21)22-15-10-16-23(19-22)27-3/h4-16,19,25H,17-18H2,1-3H3 |
| InChIKey | AXNBCGKMIXFWRA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|